C12H12F3N3O2S — CID 79095235
1-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonitrile (PubChem CID 79095235) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonitrile.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonitrile |
|---|---|
| PubChem CID | 79095235 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]sulfonylpiperazine-2-carbonitrile |
| SMILES | N#CC1CNCCN1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3O2S/c13-12(14,15)9-2-1-3-11(6-9)21(19,20)18-5-4-17-8-10(18)7-16/h1-3,6,10,17H,4-5,8H2 |
| InChIKey | WSAWHSSSHLRSHR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |