C13H15N3O4S — CID 79095226
methyl 4-(2-cyanopiperazin-1-yl)sulfonylbenzoate (PubChem CID 79095226) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl 4-(2-cyanopiperazin-1-yl)sulfonylbenzoate.
| Compound Name | methyl 4-(2-cyanopiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 79095226 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | methyl 4-(2-cyanopiperazin-1-yl)sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCNCC2C#N)cc1 |
| InChI | InChI=1S/C13H15N3O4S/c1-20-13(17)10-2-4-12(5-3-10)21(18,19)16-7-6-15-9-11(16)8-14/h2-5,11,15H,6-7,9H2,1H3 |
| InChIKey | YDDXHAUKYJUHKV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |