C11H11N3O2S2 — CID 114166079
1-(5-cyanothiophen-2-yl)sulfonylpiperidine-3-carbonitrile (PubChem CID 114166079) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-3-carbonitrile.
| Compound Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 114166079 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-3-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCCC(C#N)C2)s1 |
| InChI | InChI=1S/C11H11N3O2S2/c12-6-9-2-1-5-14(8-9)18(15,16)11-4-3-10(7-13)17-11/h3-4,9H,1-2,5,8H2 |
| InChIKey | HIHFEEGCFIANDK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |