C16H23N3O4S2 — CID 162365293
4-[(3R)-3-cyanopiperidin-1-yl]sulfonyl-N,N-diethylbenzenesulfonamide (PubChem CID 162365293) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-[(3R)-3-cyanopiperidin-1-yl]sulfonyl-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(3R)-3-cyanopiperidin-1-yl]sulfonyl-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 162365293 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 4-[(3R)-3-cyanopiperidin-1-yl]sulfonyl-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2CCC[C@@H](C#N)C2)cc1 |
| InChI | InChI=1S/C16H23N3O4S2/c1-3-18(4-2)24(20,21)15-7-9-16(10-8-15)25(22,23)19-11-5-6-14(12-17)13-19/h7-10,14H,3-6,11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | PASQSZHHWACUTQ-AWEZNQCLSA-N |
| XLogP | 1.64 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |