C17H23N3O3S — CID 49064767
4-(4-cyanopiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide (PubChem CID 49064767) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-(4-cyanopiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(4-cyanopiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 49064767 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-(4-cyanopiperidine-1-carbonyl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N2CCC(C#N)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O3S/c1-3-20(4-2)24(22,23)16-7-5-15(6-8-16)17(21)19-11-9-14(13-18)10-12-19/h5-8,14H,3-4,9-12H2,1-2H3 |
| InChIKey | JNTGZHVSICTLSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |