C12H15N3O3S2 — CID 106267798
1-(5-cyanothiophen-2-yl)sulfonyl-6-methylpiperidine-3-carboxamide (PubChem CID 106267798) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(5-cyanothiophen-2-yl)sulfonyl-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-(5-cyanothiophen-2-yl)sulfonyl-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 106267798 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(5-cyanothiophen-2-yl)sulfonyl-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1S(=O)(=O)c1ccc(C#N)s1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-8-2-3-9(12(14)16)7-15(8)20(17,18)11-5-4-10(6-13)19-11/h4-5,8-9H,2-3,7H2,1H3,(H2,14,16) |
| InChIKey | LHRBFRUYEARWMO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |