C17H27N3O5S2 — CID 129419068
(3R,6R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-6-methylpiperidine-3-carboxamide (PubChem CID 129419068) has the molecular formula C17H27N3O5S2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (3R,6R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 129419068 |
| Molecular Formula | C17H27N3O5S2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (3R,6R)-1-[4-(diethylsulfamoyl)phenyl]sulfonyl-6-methylpiperidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2C[C@H](C(N)=O)CC[C@H]2C)cc1 |
| InChI | InChI=1S/C17H27N3O5S2/c1-4-19(5-2)26(22,23)15-8-10-16(11-9-15)27(24,25)20-12-14(17(18)21)7-6-13(20)3/h8-11,13-14H,4-7,12H2,1-3H3,(H2,18,21)/t13-,14-/m1/s1 |
| InChIKey | UFAGBTFZOCCFAP-ZIAGYGMSSA-N |
| XLogP | 0.99 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |