C17H28N2O4S2 — CID 3226861
4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N,N-diethylbenzenesulfonamide (PubChem CID 3226861) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3226861 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 4-(2,6-dimethylpiperidin-1-yl)sulfonyl-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(S(=O)(=O)N2C(C)CCCC2C)cc1 |
| InChI | InChI=1S/C17H28N2O4S2/c1-5-18(6-2)24(20,21)16-10-12-17(13-11-16)25(22,23)19-14(3)8-7-9-15(19)4/h10-15H,5-9H2,1-4H3 |
| InChIKey | VOMAXTBUFOVQAG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |