C13H18INO2S — CID 1235136
(2R,6R)-1-(4-iodophenyl)sulfonyl-2,6-dimethylpiperidine (PubChem CID 1235136) has the molecular formula C13H18INO2S and a molecular weight of 379.26 g/mol. Its IUPAC name is (2R,6R)-1-(4-iodophenyl)sulfonyl-2,6-dimethylpiperidine.
| Compound Name | (2R,6R)-1-(4-iodophenyl)sulfonyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 1235136 |
| Molecular Formula | C13H18INO2S |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (2R,6R)-1-(4-iodophenyl)sulfonyl-2,6-dimethylpiperidine |
| SMILES | C[C@@H]1CCC[C@@H](C)N1S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H18INO2S/c1-10-4-3-5-11(2)15(10)18(16,17)13-8-6-12(14)7-9-13/h6-11H,3-5H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | AIWJFPNEBGOQKP-GHMZBOCLSA-N |
| XLogP | 3.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|