C19H21Cl3N2O4S2 — CID 19684524
2,4,5-trichloro-N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 19684524) has the molecular formula C19H21Cl3N2O4S2 and a molecular weight of 511.88 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19684524 |
| Molecular Formula | C19H21Cl3N2O4S2 |
| Molecular Weight | 511.88 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 2,4,5-trichloro-N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl3N2O4S2/c1-12-4-3-5-13(2)24(12)30(27,28)15-8-6-14(7-9-15)23-29(25,26)19-11-17(21)16(20)10-18(19)22/h6-13,23H,3-5H2,1-2H3 |
| InChIKey | JCLNWNRTBQNWMZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.88 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|