C20H24N2O6S2 — CID 42913165
3-[[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]sulfamoyl]benzoic acid (PubChem CID 42913165) has the molecular formula C20H24N2O6S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 42913165 |
| Molecular Formula | C20H24N2O6S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 3-[[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]sulfamoyl]benzoic acid |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccc(NS(=O)(=O)c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H24N2O6S2/c1-14-5-3-6-15(2)22(14)30(27,28)18-11-9-17(10-12-18)21-29(25,26)19-8-4-7-16(13-19)20(23)24/h4,7-15,21H,3,5-6H2,1-2H3,(H,23,24) |
| InChIKey | QFVNNPVHGJTWQG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |