C22H25N3O4S2 — CID 19684514
N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]quinoline-8-sulfonamide (PubChem CID 19684514) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 19684514 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[4-(2,6-dimethylpiperidin-1-yl)sulfonylphenyl]quinoline-8-sulfonamide |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-16-6-3-7-17(2)25(16)31(28,29)20-13-11-19(12-14-20)24-30(26,27)21-10-4-8-18-9-5-15-23-22(18)21/h4-5,8-17,24H,3,6-7H2,1-2H3 |
| InChIKey | WHVLVVHETFXCRO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |