C22H22N2O4S — CID 7573617
cyclohexyl 4-(quinolin-8-ylsulfonylamino)benzoate (PubChem CID 7573617) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is cyclohexyl 4-(quinolin-8-ylsulfonylamino)benzoate.
| Compound Name | cyclohexyl 4-(quinolin-8-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 7573617 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | cyclohexyl 4-(quinolin-8-ylsulfonylamino)benzoate |
| SMILES | O=C(OC1CCCCC1)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c25-22(28-19-8-2-1-3-9-19)17-11-13-18(14-12-17)24-29(26,27)20-10-4-6-16-7-5-15-23-21(16)20/h4-7,10-15,19,24H,1-3,8-9H2 |
| InChIKey | KBZWWKLUCSSEDO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |