C17H18N2O3S — CID 96565285
(1R,6S)-N-quinolin-8-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 96565285) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (1R,6S)-N-quinolin-8-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6S)-N-quinolin-8-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 96565285 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (1R,6S)-N-quinolin-8-ylsulfonylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccc2cccnc12)C1[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H18N2O3S/c20-17(15-12-7-1-2-8-13(12)15)19-23(21,22)14-9-3-5-11-6-4-10-18-16(11)14/h3-6,9-10,12-13,15H,1-2,7-8H2,(H,19,20)/t12-,13+,15? |
| InChIKey | CXBFIGMFWYLZFL-NNQSOWQGSA-N |
| XLogP | 2.48 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |