C16H18N2O4S — CID 11522844
1-(quinolin-8-ylsulfonylamino)cyclohexane-1-carboxylic acid (PubChem CID 11522844) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(quinolin-8-ylsulfonylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(quinolin-8-ylsulfonylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11522844 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(quinolin-8-ylsulfonylamino)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)c2cccc3cccnc23)CCCCC1 |
| InChI | InChI=1S/C16H18N2O4S/c19-15(20)16(9-2-1-3-10-16)18-23(21,22)13-8-4-6-12-7-5-11-17-14(12)13/h4-8,11,18H,1-3,9-10H2,(H,19,20) |
| InChIKey | SQOAGFMLTLFKOO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |