C24H29N3O3S — CID 90294344
N-(1-adamantyl)-1-(quinolin-8-ylsulfonylamino)cyclobutane-1-carboxamide (PubChem CID 90294344) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(quinolin-8-ylsulfonylamino)cyclobutane-1-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(quinolin-8-ylsulfonylamino)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 90294344 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-(1-adamantyl)-1-(quinolin-8-ylsulfonylamino)cyclobutane-1-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C1(NS(=O)(=O)c2cccc3cccnc23)CCC1 |
| InChI | InChI=1S/C24H29N3O3S/c28-22(26-23-13-16-10-17(14-23)12-18(11-16)15-23)24(7-3-8-24)27-31(29,30)20-6-1-4-19-5-2-9-25-21(19)20/h1-2,4-6,9,16-18,27H,3,7-8,10-15H2,(H,26,28) |
| InChIKey | NGGIKIQJGZAAPO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |