C24H30N4O4S — CID 90294234
3-[[2-methyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]adamantane-1-carboxamide (PubChem CID 90294234) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 3-[[2-methyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]adamantane-1-carboxamide.
| Compound Name | 3-[[2-methyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 90294234 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 3-[[2-methyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]adamantane-1-carboxamide |
| SMILES | CC(C)(NS(=O)(=O)c1cccc2cccnc12)C(=O)NC12CC3CC(C1)CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C24H30N4O4S/c1-22(2,28-33(31,32)18-7-3-5-17-6-4-8-26-19(17)18)21(30)27-24-12-15-9-16(13-24)11-23(10-15,14-24)20(25)29/h3-8,15-16,28H,9-14H2,1-2H3,(H2,25,29)(H,27,30) |
| InChIKey | RYYBXYQULBDFNK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |