C18H12Cl4N2O4S2 — CID 22202651
2,4,5-trichloro-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 22202651) has the molecular formula C18H12Cl4N2O4S2 and a molecular weight of 526.25 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22202651 |
| Molecular Formula | C18H12Cl4N2O4S2 |
| Molecular Weight | 526.25 g/mol |
| Exact Mass | 523.90 |
| IUPAC Name | 2,4,5-trichloro-N-[4-[(4-chlorophenyl)sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H12Cl4N2O4S2/c19-11-1-3-12(4-2-11)23-29(25,26)14-7-5-13(6-8-14)24-30(27,28)18-10-16(21)15(20)9-17(18)22/h1-10,23-24H |
| InChIKey | HBVHJXCMWVQSOP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.25 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|