C13H7Cl3NO4S- — CID 7477012
4-[(2,4,5-trichlorophenyl)sulfonylamino]benzoate (PubChem CID 7477012) has the molecular formula C13H7Cl3NO4S- and a molecular weight of 379.63 g/mol. Its IUPAC name is 4-[(2,4,5-trichlorophenyl)sulfonylamino]benzoate.
| Compound Name | 4-[(2,4,5-trichlorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 7477012 |
| Molecular Formula | C13H7Cl3NO4S- |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | 4-[(2,4,5-trichlorophenyl)sulfonylamino]benzoate |
| SMILES | O=C([O-])c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H8Cl3NO4S/c14-9-5-11(16)12(6-10(9)15)22(20,21)17-8-3-1-7(2-4-8)13(18)19/h1-6,17H,(H,18,19)/p-1 |
| InChIKey | FWKGDOBWAMRATO-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|