C14H11FNO4S- — CID 7040246
4-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoate (PubChem CID 7040246) has the molecular formula C14H11FNO4S- and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoate.
| Compound Name | 4-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 7040246 |
| Molecular Formula | C14H11FNO4S- |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-[(5-fluoro-2-methylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H12FNO4S/c1-9-2-5-11(15)8-13(9)21(19,20)16-12-6-3-10(4-7-12)14(17)18/h2-8,16H,1H3,(H,17,18)/p-1 |
| InChIKey | MHOKECSBIJUSOY-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |