C16H16NO6S- — CID 8822569
3-[(3,5-dimethoxyphenyl)sulfamoyl]-4-methylbenzoate (PubChem CID 8822569) has the molecular formula C16H16NO6S- and a molecular weight of 350.37 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)sulfamoyl]-4-methylbenzoate.
| Compound Name | 3-[(3,5-dimethoxyphenyl)sulfamoyl]-4-methylbenzoate |
|---|---|
| PubChem CID | 8822569 |
| Molecular Formula | C16H16NO6S- |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)sulfamoyl]-4-methylbenzoate |
| SMILES | COc1cc(NS(=O)(=O)c2cc(C(=O)[O-])ccc2C)cc(OC)c1 |
| InChI | InChI=1S/C16H17NO6S/c1-10-4-5-11(16(18)19)6-15(10)24(20,21)17-12-7-13(22-2)9-14(8-12)23-3/h4-9,17H,1-3H3,(H,18,19)/p-1 |
| InChIKey | BFUASUBQFCCDDH-UHFFFAOYSA-M |
| XLogP | 1.18 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |