C16H16NO5S- — CID 7286055
2-[4-[(5-methoxy-2-methylphenyl)sulfonylamino]phenyl]acetate (PubChem CID 7286055) has the molecular formula C16H16NO5S- and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[4-[(5-methoxy-2-methylphenyl)sulfonylamino]phenyl]acetate.
| Compound Name | 2-[4-[(5-methoxy-2-methylphenyl)sulfonylamino]phenyl]acetate |
|---|---|
| PubChem CID | 7286055 |
| Molecular Formula | C16H16NO5S- |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-[4-[(5-methoxy-2-methylphenyl)sulfonylamino]phenyl]acetate |
| SMILES | COc1ccc(C)c(S(=O)(=O)Nc2ccc(CC(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H17NO5S/c1-11-3-8-14(22-2)10-15(11)23(20,21)17-13-6-4-12(5-7-13)9-16(18)19/h3-8,10,17H,9H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | IPUHZZJMSDYZCP-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |