C16H19NO4S — CID 19683549
N-(3,4-dimethylphenyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 19683549) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19683549 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(C)c(C)c2)c(OC)c1 |
| InChI | InChI=1S/C16H19NO4S/c1-11-5-6-13(9-12(11)2)17-22(18,19)16-8-7-14(20-3)10-15(16)21-4/h5-10,17H,1-4H3 |
| InChIKey | WHQDUYVLGJEWLO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |