C14H16N2O4S — CID 43602608
N-(4-aminophenyl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 43602608) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-(4-aminophenyl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(4-aminophenyl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43602608 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(4-aminophenyl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(N)cc2)c(OC)c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-19-12-7-8-14(13(9-12)20-2)21(17,18)16-11-5-3-10(15)4-6-11/h3-9,16H,15H2,1-2H3 |
| InChIKey | ZYSGLYAKTICOMQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|