C15H15NO6S — CID 22774071
N-(1,3-benzodioxol-5-yl)-2,4-dimethoxybenzenesulfonamide (PubChem CID 22774071) has the molecular formula C15H15NO6S and a molecular weight of 337.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22774071 |
| Molecular Formula | C15H15NO6S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C15H15NO6S/c1-19-11-4-6-15(14(8-11)20-2)23(17,18)16-10-3-5-12-13(7-10)22-9-21-12/h3-8,16H,9H2,1-2H3 |
| InChIKey | BPAABFXIWSXZOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|