C17H22N2O4S — CID 112979777
2,4-dimethoxy-N-[4-(propylamino)phenyl]benzenesulfonamide (PubChem CID 112979777) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[4-(propylamino)phenyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[4-(propylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112979777 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2,4-dimethoxy-N-[4-(propylamino)phenyl]benzenesulfonamide |
| SMILES | CCCNc1ccc(NS(=O)(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-4-11-18-13-5-7-14(8-6-13)19-24(20,21)17-10-9-15(22-2)12-16(17)23-3/h5-10,12,18-19H,4,11H2,1-3H3 |
| InChIKey | GRIIINACURWKKT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |