C15H17NO5S — CID 22774026
2,4-dimethoxy-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 22774026) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22774026 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2,4-dimethoxy-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C15H17NO5S/c1-19-12-6-4-11(5-7-12)16-22(17,18)15-9-8-13(20-2)10-14(15)21-3/h4-10,16H,1-3H3 |
| InChIKey | PRKCSHFLJDPLCD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |