C18H24N2O3S — CID 112980291
N-[4-(butylamino)phenyl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 112980291) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[4-(butylamino)phenyl]-4-methoxy-2-methylbenzenesulfonamide.
| Compound Name | N-[4-(butylamino)phenyl]-4-methoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112980291 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[4-(butylamino)phenyl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | CCCCNc1ccc(NS(=O)(=O)c2ccc(OC)cc2C)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-4-5-12-19-15-6-8-16(9-7-15)20-24(21,22)18-11-10-17(23-3)13-14(18)2/h6-11,13,19-20H,4-5,12H2,1-3H3 |
| InChIKey | VIXYGTPCTVTVLT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|