C20H21N3O3S — CID 112983082
4-methoxy-2-methyl-N-[4-(pyridin-3-ylmethylamino)phenyl]benzenesulfonamide (PubChem CID 112983082) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[4-(pyridin-3-ylmethylamino)phenyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[4-(pyridin-3-ylmethylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112983082 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-methoxy-2-methyl-N-[4-(pyridin-3-ylmethylamino)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NCc3cccnc3)cc2)c(C)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-15-12-19(26-2)9-10-20(15)27(24,25)23-18-7-5-17(6-8-18)22-14-16-4-3-11-21-13-16/h3-13,22-23H,14H2,1-2H3 |
| InChIKey | AZAMTXJKGKQLLJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |