C19H26N2O2S — CID 112985250
3,4-dimethyl-N-[4-(pentylamino)phenyl]benzenesulfonamide (PubChem CID 112985250) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(pentylamino)phenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[4-(pentylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112985250 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 3,4-dimethyl-N-[4-(pentylamino)phenyl]benzenesulfonamide |
| SMILES | CCCCCNc1ccc(NS(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C19H26N2O2S/c1-4-5-6-13-20-17-8-10-18(11-9-17)21-24(22,23)19-12-7-15(2)16(3)14-19/h7-12,14,20-21H,4-6,13H2,1-3H3 |
| InChIKey | HZGGWDMWEQCNKG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|