C14H14ClNO2S — CID 7985042
N-(4-chlorophenyl)-3,4-dimethylbenzenesulfonamide (PubChem CID 7985042) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 7985042 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-(4-chlorophenyl)-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C14H14ClNO2S/c1-10-3-8-14(9-11(10)2)19(17,18)16-13-6-4-12(15)5-7-13/h3-9,16H,1-2H3 |
| InChIKey | SAGSRPFUFAHKDM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |