C19H15Cl2NO4S2 — CID 1089389
N-(4-chlorophenyl)-5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide (PubChem CID 1089389) has the molecular formula C19H15Cl2NO4S2 and a molecular weight of 456.37 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1089389 |
| Molecular Formula | C19H15Cl2NO4S2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | N-(4-chlorophenyl)-5-(4-chlorophenyl)sulfonyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl2NO4S2/c1-13-2-9-18(27(23,24)17-10-5-15(21)6-11-17)12-19(13)28(25,26)22-16-7-3-14(20)4-8-16/h2-12,22H,1H3 |
| InChIKey | WSXNEBHYPMMRLR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |