C16H16ClNO6S2 — CID 992315
(2S)-2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoic acid (PubChem CID 992315) has the molecular formula C16H16ClNO6S2 and a molecular weight of 417.89 g/mol. Its IUPAC name is (2S)-2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 992315 |
| Molecular Formula | C16H16ClNO6S2 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | (2S)-2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C16H16ClNO6S2/c1-10-3-6-14(25(21,22)13-7-4-12(17)5-8-13)9-15(10)26(23,24)18-11(2)16(19)20/h3-9,11,18H,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | DDLWYJYOMDGBEN-NSHDSACASA-N |
| XLogP | 2.23 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |