C19H24ClN3O5S2 — CID 32996069
(2S)-2-[(4-chlorophenyl)sulfonylamino]-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]propanamide (PubChem CID 32996069) has the molecular formula C19H24ClN3O5S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)sulfonylamino]-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]propanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)sulfonylamino]-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 32996069 |
| Molecular Formula | C19H24ClN3O5S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)sulfonylamino]-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]propanamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)[C@H](C)NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H24ClN3O5S2/c1-13-4-5-14(2)18(12-13)30(27,28)22-11-10-21-19(24)15(3)23-29(25,26)17-8-6-16(20)7-9-17/h4-9,12,15,22-23H,10-11H2,1-3H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | HNPJKHNKEKNHED-HNNXBMFYSA-N |
| XLogP | 1.72 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|