C16H15ClNO6S2- — CID 78554929
2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoate (PubChem CID 78554929) has the molecular formula C16H15ClNO6S2- and a molecular weight of 416.88 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoate.
| Compound Name | 2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 78554929 |
| Molecular Formula | C16H15ClNO6S2- |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)sulfonyl-2-methylphenyl]sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)NC(C)C(=O)[O-] |
| InChI | InChI=1S/C16H16ClNO6S2/c1-10-3-6-14(25(21,22)13-7-4-12(17)5-8-13)9-15(10)26(23,24)18-11(2)16(19)20/h3-9,11,18H,1-2H3,(H,19,20)/p-1 |
| InChIKey | DDLWYJYOMDGBEN-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |