C18H15ClNO5S- — CID 7811833
(2S)-2-[[4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl]sulfonylamino]propanoate (PubChem CID 7811833) has the molecular formula C18H15ClNO5S- and a molecular weight of 392.84 g/mol. Its IUPAC name is (2S)-2-[[4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl]sulfonylamino]propanoate.
| Compound Name | (2S)-2-[[4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7811833 |
| Molecular Formula | C18H15ClNO5S- |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (2S)-2-[[4-[(E)-3-(4-chlorophenyl)prop-2-enoyl]phenyl]sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(C(=O)/C=C/c2ccc(Cl)cc2)cc1)C(=O)[O-] |
| InChI | InChI=1S/C18H16ClNO5S/c1-12(18(22)23)20-26(24,25)16-9-5-14(6-10-16)17(21)11-4-13-2-7-15(19)8-3-13/h2-12,20H,1H3,(H,22,23)/p-1/b11-4+/t12-/m0/s1 |
| InChIKey | FQBUNYLGZVLAHO-QNCMIEPLSA-M |
| XLogP | 1.65 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|