C14H20NO4S- — CID 6940754
(2S)-2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoate (PubChem CID 6940754) has the molecular formula C14H20NO4S- and a molecular weight of 298.38 g/mol. Its IUPAC name is (2S)-2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoate.
| Compound Name | (2S)-2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 6940754 |
| Molecular Formula | C14H20NO4S- |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2S)-2-[(2,5-dimethylphenyl)sulfonylamino]-4-methylpentanoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N[C@@H](CC(C)C)C(=O)[O-])c1 |
| InChI | InChI=1S/C14H21NO4S/c1-9(2)7-12(14(16)17)15-20(18,19)13-8-10(3)5-6-11(13)4/h5-6,8-9,12,15H,7H2,1-4H3,(H,16,17)/p-1/t12-/m0/s1 |
| InChIKey | YKLYILQBCOVJHM-LBPRGKRZSA-M |
| XLogP | 0.75 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |