C12H20N2O2S — CID 55033374
N-(4-aminobutan-2-yl)-2,5-dimethylbenzenesulfonamide (PubChem CID 55033374) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(4-aminobutan-2-yl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55033374 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-(4-aminobutan-2-yl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(C)CCN)c1 |
| InChI | InChI=1S/C12H20N2O2S/c1-9-4-5-10(2)12(8-9)17(15,16)14-11(3)6-7-13/h4-5,8,11,14H,6-7,13H2,1-3H3 |
| InChIKey | HOOQWOBDEMNZRZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |