C11H16ClNO2S — CID 65031366
N-(1-chloropropan-2-yl)-2,4-dimethylbenzenesulfonamide (PubChem CID 65031366) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-(1-chloropropan-2-yl)-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 65031366 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-(1-chloropropan-2-yl)-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CCl)c(C)c1 |
| InChI | InChI=1S/C11H16ClNO2S/c1-8-4-5-11(9(2)6-8)16(14,15)13-10(3)7-12/h4-6,10,13H,7H2,1-3H3 |
| InChIKey | BMMOEAJBVLFVQC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|