C13H19NO2S — CID 84843581
N-(1-cyclopropylethyl)-2,4-dimethylbenzenesulfonamide (PubChem CID 84843581) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-(1-cyclopropylethyl)-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 84843581 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(1-cyclopropylethyl)-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C2CC2)c(C)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-9-4-7-13(10(2)8-9)17(15,16)14-11(3)12-5-6-12/h4,7-8,11-12,14H,5-6H2,1-3H3 |
| InChIKey | FFIWYRXXUZORCK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |