C11H13ClN2O2S — CID 106442039
N-(1-chloropropan-2-yl)-5-cyano-2-methylbenzenesulfonamide (PubChem CID 106442039) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-5-cyano-2-methylbenzenesulfonamide.
| Compound Name | N-(1-chloropropan-2-yl)-5-cyano-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106442039 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(1-chloropropan-2-yl)-5-cyano-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)NC(C)CCl |
| InChI | InChI=1S/C11H13ClN2O2S/c1-8-3-4-10(7-13)5-11(8)17(15,16)14-9(2)6-12/h3-5,9,14H,6H2,1-2H3 |
| InChIKey | UIHKONNMAUFTRT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|