C15H23N3O2S — CID 106035216
5-cyano-2-methyl-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide (PubChem CID 106035216) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 5-cyano-2-methyl-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide.
| Compound Name | 5-cyano-2-methyl-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106035216 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-cyano-2-methyl-N-[3-[methyl(propan-2-yl)amino]propyl]benzenesulfonamide |
| SMILES | Cc1ccc(C#N)cc1S(=O)(=O)NCCCN(C)C(C)C |
| InChI | InChI=1S/C15H23N3O2S/c1-12(2)18(4)9-5-8-17-21(19,20)15-10-14(11-16)7-6-13(15)3/h6-7,10,12,17H,5,8-9H2,1-4H3 |
| InChIKey | QGXVXSSIKBIDQM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|