C12H16N2O3S — CID 106997450
4-cyano-N-(4-hydroxybutyl)-2-methylbenzenesulfonamide (PubChem CID 106997450) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-cyano-N-(4-hydroxybutyl)-2-methylbenzenesulfonamide.
| Compound Name | 4-cyano-N-(4-hydroxybutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106997450 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-cyano-N-(4-hydroxybutyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)NCCCCO |
| InChI | InChI=1S/C12H16N2O3S/c1-10-8-11(9-13)4-5-12(10)18(16,17)14-6-2-3-7-15/h4-5,8,14-15H,2-3,6-7H2,1H3 |
| InChIKey | ABDFAIGRWKYING-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|