C13H18NO4S- — CID 78429212
2-[(2,5-dimethylphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 78429212) has the molecular formula C13H18NO4S- and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 78429212 |
| Molecular Formula | C13H18NO4S- |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(C(=O)[O-])C(C)C)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-8(2)12(13(15)16)14-19(17,18)11-7-9(3)5-6-10(11)4/h5-8,12,14H,1-4H3,(H,15,16)/p-1 |
| InChIKey | RSFWLMSKHBUENF-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |