C9H8Cl2NO4S- — CID 6922951
(2R)-2-[(2,6-dichlorophenyl)sulfonylamino]propanoate (PubChem CID 6922951) has the molecular formula C9H8Cl2NO4S- and a molecular weight of 297.14 g/mol. Its IUPAC name is (2R)-2-[(2,6-dichlorophenyl)sulfonylamino]propanoate.
| Compound Name | (2R)-2-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 6922951 |
| Molecular Formula | C9H8Cl2NO4S- |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | (2R)-2-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@@H](NS(=O)(=O)c1c(Cl)cccc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C9H9Cl2NO4S/c1-5(9(13)14)12-17(15,16)8-6(10)3-2-4-7(8)11/h2-5,12H,1H3,(H,13,14)/p-1/t5-/m1/s1 |
| InChIKey | PAUBDKVONJBMDJ-RXMQYKEDSA-M |
| XLogP | 0.41 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |