C14H21NO4S — CID 78972782
(2R)-2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 78972782) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (2R)-2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2R)-2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 78972782 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2R)-2-[(5-tert-butyl-2-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C14H21NO4S/c1-9-6-7-11(14(3,4)5)8-12(9)20(18,19)15-10(2)13(16)17/h6-8,10,15H,1-5H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | NNTVTJKCUMYTGI-SNVBAGLBSA-N |
| XLogP | 2.04 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |