C21H21ClN2O4S2 — CID 3637891
4-[(4-chlorophenyl)sulfonylamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide (PubChem CID 3637891) has the molecular formula C21H21ClN2O4S2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide.
| Compound Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3637891 |
| Molecular Formula | C21H21ClN2O4S2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(NS(=O)(=O)c3ccc(Cl)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H21ClN2O4S2/c1-14-12-15(2)21(16(3)13-14)24-30(27,28)20-10-6-18(7-11-20)23-29(25,26)19-8-4-17(22)5-9-19/h4-13,23-24H,1-3H3 |
| InChIKey | XRMXQXKHGMXCGQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |