C14H13BrClNO2S — CID 107575174
N-(4-bromo-3,5-dimethylphenyl)-4-chlorobenzenesulfonamide (PubChem CID 107575174) has the molecular formula C14H13BrClNO2S and a molecular weight of 374.69 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 107575174 |
| Molecular Formula | C14H13BrClNO2S |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-4-chlorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(Cl)cc2)cc(C)c1Br |
| InChI | InChI=1S/C14H13BrClNO2S/c1-9-7-12(8-10(2)14(9)15)17-20(18,19)13-5-3-11(16)4-6-13/h3-8,17H,1-2H3 |
| InChIKey | KBYWYUNPLGSVHS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |