C15H12NO7S- — CID 6980392
5-(1,3-benzodioxol-5-ylsulfamoyl)-2-methoxybenzoate (PubChem CID 6980392) has the molecular formula C15H12NO7S- and a molecular weight of 350.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylsulfamoyl)-2-methoxybenzoate.
| Compound Name | 5-(1,3-benzodioxol-5-ylsulfamoyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 6980392 |
| Molecular Formula | C15H12NO7S- |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylsulfamoyl)-2-methoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3c(c2)OCO3)cc1C(=O)[O-] |
| InChI | InChI=1S/C15H13NO7S/c1-21-12-5-3-10(7-11(12)15(17)18)24(19,20)16-9-2-4-13-14(6-9)23-8-22-13/h2-7,16H,8H2,1H3,(H,17,18)/p-1 |
| InChIKey | CBTNVZLUXBMTAM-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|