C16H17N3O7S — CID 17267012
1-(1,3-benzodioxol-5-yl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]urea (PubChem CID 17267012) has the molecular formula C16H17N3O7S and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 17267012 |
| Molecular Formula | C16H17N3O7S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(3,4-dimethoxyphenyl)sulfonylamino]urea |
| SMILES | COc1ccc(S(=O)(=O)NNC(=O)Nc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C16H17N3O7S/c1-23-12-6-4-11(8-14(12)24-2)27(21,22)19-18-16(20)17-10-3-5-13-15(7-10)26-9-25-13/h3-8,19H,9H2,1-2H3,(H2,17,18,20) |
| InChIKey | IVGZZELVLSQGTD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|